C32H39N9O — CID 162356164
1-[(3S)-3-[8-anilino-2-[4-[4-(dimethylamino)piperidin-1-yl]anilino]purin-9-yl]piperidin-1-yl]prop-2-en-1-one (PubChem CID 162356164) has the molecular formula C32H39N9O and a molecular weight of 565.73 g/mol. Its IUPAC name is 1-[(3S)-3-[8-anilino-2-[4-[4-(dimethylamino)piperidin-1-yl]anilino]purin-9-yl]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(3S)-3-[8-anilino-2-[4-[4-(dimethylamino)piperidin-1-yl]anilino]purin-9-yl]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 162356164 |
| Molecular Formula | C32H39N9O |
| Molecular Weight | 565.73 g/mol |
| Exact Mass | 565.33 |
| IUPAC Name | 1-[(3S)-3-[8-anilino-2-[4-[4-(dimethylamino)piperidin-1-yl]anilino]purin-9-yl]piperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC[C@H](n2c(Nc3ccccc3)nc3cnc(Nc4ccc(N5CCC(N(C)C)CC5)cc4)nc32)C1 |
| InChI | InChI=1S/C32H39N9O/c1-4-29(42)40-18-8-11-27(22-40)41-30-28(36-32(41)35-23-9-6-5-7-10-23)21-33-31(37-30)34-24-12-14-26(15-13-24)39-19-16-25(17-20-39)38(2)3/h4-7,9-10,12-15,21,25,27H,1,8,11,16-20,22H2,2-3H3,(H,35,36)(H,33,34,37)/t27-/m0/s1 |
| InChIKey | FMFQLBRCIAAWMX-MHZLTWQESA-N |
| XLogP | 5.19 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.73 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|