C32H40N8O2 — CID 172553766
tert-butyl 4-[2-[(8-anilino-9-cyclohexylpurin-2-yl)amino]phenyl]piperazine-1-carboxylate (PubChem CID 172553766) has the molecular formula C32H40N8O2 and a molecular weight of 568.73 g/mol. Its IUPAC name is tert-butyl 4-[2-[(8-anilino-9-cyclohexylpurin-2-yl)amino]phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[(8-anilino-9-cyclohexylpurin-2-yl)amino]phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 172553766 |
| Molecular Formula | C32H40N8O2 |
| Molecular Weight | 568.73 g/mol |
| Exact Mass | 568.33 |
| IUPAC Name | tert-butyl 4-[2-[(8-anilino-9-cyclohexylpurin-2-yl)amino]phenyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccccc2Nc2ncc3nc(Nc4ccccc4)n(C4CCCCC4)c3n2)CC1 |
| InChI | InChI=1S/C32H40N8O2/c1-32(2,3)42-31(41)39-20-18-38(19-21-39)27-17-11-10-16-25(27)35-29-33-22-26-28(37-29)40(24-14-8-5-9-15-24)30(36-26)34-23-12-6-4-7-13-23/h4,6-7,10-13,16-17,22,24H,5,8-9,14-15,18-21H2,1-3H3,(H,34,36)(H,33,35,37) |
| InChIKey | OJCNYWKBVPSDCJ-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 100.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.73 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |