C31H36N8OS — CID 162356158
1-[(3S)-3-[2-[4-[4-(dimethylamino)piperidin-1-yl]anilino]-8-phenylsulfanylpurin-9-yl]pyrrolidin-1-yl]prop-2-en-1-one (PubChem CID 162356158) has the molecular formula C31H36N8OS and a molecular weight of 568.75 g/mol. Its IUPAC name is 1-[(3S)-3-[2-[4-[4-(dimethylamino)piperidin-1-yl]anilino]-8-phenylsulfanylpurin-9-yl]pyrrolidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(3S)-3-[2-[4-[4-(dimethylamino)piperidin-1-yl]anilino]-8-phenylsulfanylpurin-9-yl]pyrrolidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 162356158 |
| Molecular Formula | C31H36N8OS |
| Molecular Weight | 568.75 g/mol |
| Exact Mass | 568.27 |
| IUPAC Name | 1-[(3S)-3-[2-[4-[4-(dimethylamino)piperidin-1-yl]anilino]-8-phenylsulfanylpurin-9-yl]pyrrolidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC[C@H](n2c(Sc3ccccc3)nc3cnc(Nc4ccc(N5CCC(N(C)C)CC5)cc4)nc32)C1 |
| InChI | InChI=1S/C31H36N8OS/c1-4-28(40)38-19-16-25(21-38)39-29-27(34-31(39)41-26-8-6-5-7-9-26)20-32-30(35-29)33-22-10-12-24(13-11-22)37-17-14-23(15-18-37)36(2)3/h4-13,20,23,25H,1,14-19,21H2,2-3H3,(H,32,33,35)/t25-/m0/s1 |
| InChIKey | UIWRWXGINUBIDG-VWLOTQADSA-N |
| XLogP | 5.21 |
| TPSA | 82.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.75 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|