C24H32N8O — CID 144937312
1-[3-[[5,6-diamino-2-(4-piperidin-1-ylanilino)pyrimidin-4-yl]-ethenylamino]pyrrolidin-1-yl]prop-2-en-1-one (PubChem CID 144937312) has the molecular formula C24H32N8O and a molecular weight of 448.58 g/mol. Its IUPAC name is 1-[3-[[5,6-diamino-2-(4-piperidin-1-ylanilino)pyrimidin-4-yl]-ethenylamino]pyrrolidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-[[5,6-diamino-2-(4-piperidin-1-ylanilino)pyrimidin-4-yl]-ethenylamino]pyrrolidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 144937312 |
| Molecular Formula | C24H32N8O |
| Molecular Weight | 448.58 g/mol |
| Exact Mass | 448.27 |
| IUPAC Name | 1-[3-[[5,6-diamino-2-(4-piperidin-1-ylanilino)pyrimidin-4-yl]-ethenylamino]pyrrolidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC(N(C=C)c2nc(Nc3ccc(N4CCCCC4)cc3)nc(N)c2N)C1 |
| InChI | InChI=1S/C24H32N8O/c1-3-20(33)31-15-12-19(16-31)32(4-2)23-21(25)22(26)28-24(29-23)27-17-8-10-18(11-9-17)30-13-6-5-7-14-30/h3-4,8-11,19H,1-2,5-7,12-16,25H2,(H3,26,27,28,29) |
| InChIKey | AYZCPRCFHTUDKB-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 116.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.58 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|