C33H41N9O4S — CID 162356163
[8-anilino-2-[4-[4-(dimethylamino)piperidin-1-yl]anilino]-9-[(3S)-1-prop-2-enoylpiperidin-3-yl]purin-6-yl] methanesulfonate (PubChem CID 162356163) has the molecular formula C33H41N9O4S and a molecular weight of 659.82 g/mol. Its IUPAC name is [8-anilino-2-[4-[4-(dimethylamino)piperidin-1-yl]anilino]-9-[(3S)-1-prop-2-enoylpiperidin-3-yl]purin-6-yl] methanesulfonate.
| Compound Name | [8-anilino-2-[4-[4-(dimethylamino)piperidin-1-yl]anilino]-9-[(3S)-1-prop-2-enoylpiperidin-3-yl]purin-6-yl] methanesulfonate |
|---|---|
| PubChem CID | 162356163 |
| Molecular Formula | C33H41N9O4S |
| Molecular Weight | 659.82 g/mol |
| Exact Mass | 659.30 |
| IUPAC Name | [8-anilino-2-[4-[4-(dimethylamino)piperidin-1-yl]anilino]-9-[(3S)-1-prop-2-enoylpiperidin-3-yl]purin-6-yl] methanesulfonate |
| SMILES | C=CC(=O)N1CCC[C@H](n2c(Nc3ccccc3)nc3c(OS(C)(=O)=O)nc(Nc4ccc(N5CCC(N(C)C)CC5)cc4)nc32)C1 |
| InChI | InChI=1S/C33H41N9O4S/c1-5-28(43)41-19-9-12-27(22-41)42-30-29(36-33(42)35-23-10-7-6-8-11-23)31(46-47(4,44)45)38-32(37-30)34-24-13-15-26(16-14-24)40-20-17-25(18-21-40)39(2)3/h5-8,10-11,13-16,25,27H,1,9,12,17-22H2,2-4H3,(H,35,36)(H,34,37,38)/t27-/m0/s1 |
| InChIKey | BWLXXOFPDPCNPB-MHZLTWQESA-N |
| XLogP | 4.53 |
| TPSA | 137.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.82 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|