C34H45N9O2 — CID 175365183
ethyl 7-[4-[4-[[8-anilino-9-[(3S)-pyrrolidin-3-yl]purin-2-yl]amino]phenyl]piperazin-1-yl]heptanoate (PubChem CID 175365183) has the molecular formula C34H45N9O2 and a molecular weight of 611.80 g/mol. Its IUPAC name is ethyl 7-[4-[4-[[8-anilino-9-[(3S)-pyrrolidin-3-yl]purin-2-yl]amino]phenyl]piperazin-1-yl]heptanoate.
| Compound Name | ethyl 7-[4-[4-[[8-anilino-9-[(3S)-pyrrolidin-3-yl]purin-2-yl]amino]phenyl]piperazin-1-yl]heptanoate |
|---|---|
| PubChem CID | 175365183 |
| Molecular Formula | C34H45N9O2 |
| Molecular Weight | 611.80 g/mol |
| Exact Mass | 611.37 |
| IUPAC Name | ethyl 7-[4-[4-[[8-anilino-9-[(3S)-pyrrolidin-3-yl]purin-2-yl]amino]phenyl]piperazin-1-yl]heptanoate |
| SMILES | CCOC(=O)CCCCCCN1CCN(c2ccc(Nc3ncc4nc(Nc5ccccc5)n([C@H]5CCNC5)c4n3)cc2)CC1 |
| InChI | InChI=1S/C34H45N9O2/c1-2-45-31(44)12-8-3-4-9-19-41-20-22-42(23-21-41)28-15-13-27(14-16-28)37-33-36-25-30-32(40-33)43(29-17-18-35-24-29)34(39-30)38-26-10-6-5-7-11-26/h5-7,10-11,13-16,25,29,35H,2-4,8-9,12,17-24H2,1H3,(H,38,39)(H,36,37,40)/t29-/m0/s1 |
| InChIKey | XKJTVFUYJWSULJ-LJAQVGFWSA-N |
| XLogP | 5.48 |
| TPSA | 112.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.80 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|