C40H39BrN10O4 — CID 168871622
5-[[4-[4-[(8-anilino-9-cyclopentylpurin-2-yl)amino]phenyl]piperazin-1-yl]methyl]-6-bromo-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 168871622) has the molecular formula C40H39BrN10O4 and a molecular weight of 803.72 g/mol. Its IUPAC name is 5-[[4-[4-[(8-anilino-9-cyclopentylpurin-2-yl)amino]phenyl]piperazin-1-yl]methyl]-6-bromo-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 5-[[4-[4-[(8-anilino-9-cyclopentylpurin-2-yl)amino]phenyl]piperazin-1-yl]methyl]-6-bromo-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 168871622 |
| Molecular Formula | C40H39BrN10O4 |
| Molecular Weight | 803.72 g/mol |
| Exact Mass | 802.23 |
| IUPAC Name | 5-[[4-[4-[(8-anilino-9-cyclopentylpurin-2-yl)amino]phenyl]piperazin-1-yl]methyl]-6-bromo-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3cc(Br)c(CN4CCN(c5ccc(Nc6ncc7nc(Nc8ccccc8)n(C8CCCC8)c7n6)cc5)CC4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C40H39BrN10O4/c41-31-21-30-29(37(54)51(38(30)55)33-14-15-34(52)46-36(33)53)20-24(31)23-48-16-18-49(19-17-48)27-12-10-26(11-13-27)43-39-42-22-32-35(47-39)50(28-8-4-5-9-28)40(45-32)44-25-6-2-1-3-7-25/h1-3,6-7,10-13,20-22,28,33H,4-5,8-9,14-19,23H2,(H,44,45)(H,42,43,47)(H,46,52,53) |
| InChIKey | SEKWSLZBOVUCEC-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 157.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 803.72 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|