C24H24N4O5 — CID 167063564
2-(2,6-dioxopiperidin-3-yl)-5-[4-(4-hydroxypiperidin-1-yl)anilino]isoindole-1,3-dione (PubChem CID 167063564) has the molecular formula C24H24N4O5 and a molecular weight of 448.48 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-5-[4-(4-hydroxypiperidin-1-yl)anilino]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-5-[4-(4-hydroxypiperidin-1-yl)anilino]isoindole-1,3-dione |
|---|---|
| PubChem CID | 167063564 |
| Molecular Formula | C24H24N4O5 |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-5-[4-(4-hydroxypiperidin-1-yl)anilino]isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3ccc(Nc4ccc(N5CCC(O)CC5)cc4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C24H24N4O5/c29-17-9-11-27(12-10-17)16-4-1-14(2-5-16)25-15-3-6-18-19(13-15)24(33)28(23(18)32)20-7-8-21(30)26-22(20)31/h1-6,13,17,20,25,29H,7-12H2,(H,26,30,31) |
| InChIKey | RJLOTNPQALBYPK-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 119.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|