C24H27N5O — CID 18374890
8-hex-3-yn-2-yl-2-(4-piperidin-1-ylanilino)pyrido[2,3-d]pyrimidin-7-one (PubChem CID 18374890) has the molecular formula C24H27N5O and a molecular weight of 401.51 g/mol. Its IUPAC name is 8-hex-3-yn-2-yl-2-(4-piperidin-1-ylanilino)pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 8-hex-3-yn-2-yl-2-(4-piperidin-1-ylanilino)pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 18374890 |
| Molecular Formula | C24H27N5O |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | 8-hex-3-yn-2-yl-2-(4-piperidin-1-ylanilino)pyrido[2,3-d]pyrimidin-7-one |
| SMILES | CCC#CC(C)n1c(=O)ccc2cnc(Nc3ccc(N4CCCCC4)cc3)nc21 |
| InChI | InChI=1S/C24H27N5O/c1-3-4-8-18(2)29-22(30)14-9-19-17-25-24(27-23(19)29)26-20-10-12-21(13-11-20)28-15-6-5-7-16-28/h9-14,17-18H,3,5-7,15-16H2,1-2H3,(H,25,26,27) |
| InChIKey | QRLKRTUJMXUDPI-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|