C31H27F2N5O — CID 18375050
8-[bis(4-fluorophenyl)methyl]-2-(4-piperidin-1-ylanilino)pyrido[2,3-d]pyrimidin-7-one (PubChem CID 18375050) has the molecular formula C31H27F2N5O and a molecular weight of 523.59 g/mol. Its IUPAC name is 8-[bis(4-fluorophenyl)methyl]-2-(4-piperidin-1-ylanilino)pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 8-[bis(4-fluorophenyl)methyl]-2-(4-piperidin-1-ylanilino)pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 18375050 |
| Molecular Formula | C31H27F2N5O |
| Molecular Weight | 523.59 g/mol |
| Exact Mass | 523.22 |
| IUPAC Name | 8-[bis(4-fluorophenyl)methyl]-2-(4-piperidin-1-ylanilino)pyrido[2,3-d]pyrimidin-7-one |
| SMILES | O=c1ccc2cnc(Nc3ccc(N4CCCCC4)cc3)nc2n1C(c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C31H27F2N5O/c32-24-9-4-21(5-10-24)29(22-6-11-25(33)12-7-22)38-28(39)17-8-23-20-34-31(36-30(23)38)35-26-13-15-27(16-14-26)37-18-2-1-3-19-37/h4-17,20,29H,1-3,18-19H2,(H,34,35,36) |
| InChIKey | DASRMIKJLWLNIA-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.59 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|