C25H21F3N6O — CID 118026788
7-[2-[2-(4-piperazin-1-ylanilino)-5-(trifluoromethyl)pyrimidin-4-yl]ethynyl]-2,3-dihydroisoindol-1-one (PubChem CID 118026788) has the molecular formula C25H21F3N6O and a molecular weight of 478.48 g/mol. Its IUPAC name is 7-[2-[2-(4-piperazin-1-ylanilino)-5-(trifluoromethyl)pyrimidin-4-yl]ethynyl]-2,3-dihydroisoindol-1-one.
| Compound Name | 7-[2-[2-(4-piperazin-1-ylanilino)-5-(trifluoromethyl)pyrimidin-4-yl]ethynyl]-2,3-dihydroisoindol-1-one |
|---|---|
| PubChem CID | 118026788 |
| Molecular Formula | C25H21F3N6O |
| Molecular Weight | 478.48 g/mol |
| Exact Mass | 478.17 |
| IUPAC Name | 7-[2-[2-(4-piperazin-1-ylanilino)-5-(trifluoromethyl)pyrimidin-4-yl]ethynyl]-2,3-dihydroisoindol-1-one |
| SMILES | O=C1NCc2cccc(C#Cc3nc(Nc4ccc(N5CCNCC5)cc4)ncc3C(F)(F)F)c21 |
| InChI | InChI=1S/C25H21F3N6O/c26-25(27,28)20-15-31-24(32-18-5-7-19(8-6-18)34-12-10-29-11-13-34)33-21(20)9-4-16-2-1-3-17-14-30-23(35)22(16)17/h1-3,5-8,15,29H,10-14H2,(H,30,35)(H,31,32,33) |
| InChIKey | IDYWXPIYTISJQI-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.48 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|