C21H29N7O — CID 112914776
4-[4-methyl-6-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-2-yl]piperazine-1-carbaldehyde (PubChem CID 112914776) has the molecular formula C21H29N7O and a molecular weight of 395.51 g/mol. Its IUPAC name is 4-[4-methyl-6-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-2-yl]piperazine-1-carbaldehyde.
| Compound Name | 4-[4-methyl-6-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-2-yl]piperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 112914776 |
| Molecular Formula | C21H29N7O |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.24 |
| IUPAC Name | 4-[4-methyl-6-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-2-yl]piperazine-1-carbaldehyde |
| SMILES | Cc1cc(Nc2ccc(N3CCN(C)CC3)cc2)nc(N2CCN(C=O)CC2)n1 |
| InChI | InChI=1S/C21H29N7O/c1-17-15-20(24-21(22-17)28-13-9-26(16-29)10-14-28)23-18-3-5-19(6-4-18)27-11-7-25(2)8-12-27/h3-6,15-16H,7-14H2,1-2H3,(H,22,23,24) |
| InChIKey | VTBUNIOMRZBRQB-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|