C21H21ClFN5 — CID 112922275
N-(3-chloro-4-fluorophenyl)-6-methyl-2-(4-phenylpiperazin-1-yl)pyrimidin-4-amine (PubChem CID 112922275) has the molecular formula C21H21ClFN5 and a molecular weight of 397.89 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-6-methyl-2-(4-phenylpiperazin-1-yl)pyrimidin-4-amine.
| Compound Name | N-(3-chloro-4-fluorophenyl)-6-methyl-2-(4-phenylpiperazin-1-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 112922275 |
| Molecular Formula | C21H21ClFN5 |
| Molecular Weight | 397.89 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-6-methyl-2-(4-phenylpiperazin-1-yl)pyrimidin-4-amine |
| SMILES | Cc1cc(Nc2ccc(F)c(Cl)c2)nc(N2CCN(c3ccccc3)CC2)n1 |
| InChI | InChI=1S/C21H21ClFN5/c1-15-13-20(25-16-7-8-19(23)18(22)14-16)26-21(24-15)28-11-9-27(10-12-28)17-5-3-2-4-6-17/h2-8,13-14H,9-12H2,1H3,(H,24,25,26) |
| InChIKey | YTLLWFXGQKIPHU-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.89 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |