C17H20F3N5 — CID 112914072
6-methyl-2-(4-methylpiperazin-1-yl)-N-[4-(trifluoromethyl)phenyl]pyrimidin-4-amine (PubChem CID 112914072) has the molecular formula C17H20F3N5 and a molecular weight of 351.38 g/mol. Its IUPAC name is 6-methyl-2-(4-methylpiperazin-1-yl)-N-[4-(trifluoromethyl)phenyl]pyrimidin-4-amine.
| Compound Name | 6-methyl-2-(4-methylpiperazin-1-yl)-N-[4-(trifluoromethyl)phenyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 112914072 |
| Molecular Formula | C17H20F3N5 |
| Molecular Weight | 351.38 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | 6-methyl-2-(4-methylpiperazin-1-yl)-N-[4-(trifluoromethyl)phenyl]pyrimidin-4-amine |
| SMILES | Cc1cc(Nc2ccc(C(F)(F)F)cc2)nc(N2CCN(C)CC2)n1 |
| InChI | InChI=1S/C17H20F3N5/c1-12-11-15(22-14-5-3-13(4-6-14)17(18,19)20)23-16(21-12)25-9-7-24(2)8-10-25/h3-6,11H,7-10H2,1-2H3,(H,21,22,23) |
| InChIKey | JXONTURCRYPVDS-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.38 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |