C16H18F3N5 — CID 112914123
6-methyl-2-(4-methylpiperazin-1-yl)-N-(2,3,4-trifluorophenyl)pyrimidin-4-amine (PubChem CID 112914123) has the molecular formula C16H18F3N5 and a molecular weight of 337.35 g/mol. Its IUPAC name is 6-methyl-2-(4-methylpiperazin-1-yl)-N-(2,3,4-trifluorophenyl)pyrimidin-4-amine.
| Compound Name | 6-methyl-2-(4-methylpiperazin-1-yl)-N-(2,3,4-trifluorophenyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 112914123 |
| Molecular Formula | C16H18F3N5 |
| Molecular Weight | 337.35 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | 6-methyl-2-(4-methylpiperazin-1-yl)-N-(2,3,4-trifluorophenyl)pyrimidin-4-amine |
| SMILES | Cc1cc(Nc2ccc(F)c(F)c2F)nc(N2CCN(C)CC2)n1 |
| InChI | InChI=1S/C16H18F3N5/c1-10-9-13(21-12-4-3-11(17)14(18)15(12)19)22-16(20-10)24-7-5-23(2)6-8-24/h3-4,9H,5-8H2,1-2H3,(H,20,21,22) |
| InChIKey | NFRVZHUQTGSPTR-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.35 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|