C23H26FN5 — CID 112923703
N-(2-ethylphenyl)-2-[4-(2-fluorophenyl)piperazin-1-yl]-6-methylpyrimidin-4-amine (PubChem CID 112923703) has the molecular formula C23H26FN5 and a molecular weight of 391.49 g/mol. Its IUPAC name is N-(2-ethylphenyl)-2-[4-(2-fluorophenyl)piperazin-1-yl]-6-methylpyrimidin-4-amine.
| Compound Name | N-(2-ethylphenyl)-2-[4-(2-fluorophenyl)piperazin-1-yl]-6-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 112923703 |
| Molecular Formula | C23H26FN5 |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.22 |
| IUPAC Name | N-(2-ethylphenyl)-2-[4-(2-fluorophenyl)piperazin-1-yl]-6-methylpyrimidin-4-amine |
| SMILES | CCc1ccccc1Nc1cc(C)nc(N2CCN(c3ccccc3F)CC2)n1 |
| InChI | InChI=1S/C23H26FN5/c1-3-18-8-4-6-10-20(18)26-22-16-17(2)25-23(27-22)29-14-12-28(13-15-29)21-11-7-5-9-19(21)24/h4-11,16H,3,12-15H2,1-2H3,(H,25,26,27) |
| InChIKey | ANSKMYCPABOYQU-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |