C20H28FN5 — CID 112923684
2-[4-(2-fluorophenyl)piperazin-1-yl]-6-methyl-N-(3-methylbutyl)pyrimidin-4-amine (PubChem CID 112923684) has the molecular formula C20H28FN5 and a molecular weight of 357.48 g/mol. Its IUPAC name is 2-[4-(2-fluorophenyl)piperazin-1-yl]-6-methyl-N-(3-methylbutyl)pyrimidin-4-amine.
| Compound Name | 2-[4-(2-fluorophenyl)piperazin-1-yl]-6-methyl-N-(3-methylbutyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 112923684 |
| Molecular Formula | C20H28FN5 |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.23 |
| IUPAC Name | 2-[4-(2-fluorophenyl)piperazin-1-yl]-6-methyl-N-(3-methylbutyl)pyrimidin-4-amine |
| SMILES | Cc1cc(NCCC(C)C)nc(N2CCN(c3ccccc3F)CC2)n1 |
| InChI | InChI=1S/C20H28FN5/c1-15(2)8-9-22-19-14-16(3)23-20(24-19)26-12-10-25(11-13-26)18-7-5-4-6-17(18)21/h4-7,14-15H,8-13H2,1-3H3,(H,22,23,24) |
| InChIKey | HWLBLJREQWRESI-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |