C21H31N5 — CID 112908138
N-butyl-2-[4-(2,3-dimethylphenyl)piperazin-1-yl]-6-methylpyrimidin-4-amine (PubChem CID 112908138) has the molecular formula C21H31N5 and a molecular weight of 353.51 g/mol. Its IUPAC name is N-butyl-2-[4-(2,3-dimethylphenyl)piperazin-1-yl]-6-methylpyrimidin-4-amine.
| Compound Name | N-butyl-2-[4-(2,3-dimethylphenyl)piperazin-1-yl]-6-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 112908138 |
| Molecular Formula | C21H31N5 |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.26 |
| IUPAC Name | N-butyl-2-[4-(2,3-dimethylphenyl)piperazin-1-yl]-6-methylpyrimidin-4-amine |
| SMILES | CCCCNc1cc(C)nc(N2CCN(c3cccc(C)c3C)CC2)n1 |
| InChI | InChI=1S/C21H31N5/c1-5-6-10-22-20-15-17(3)23-21(24-20)26-13-11-25(12-14-26)19-9-7-8-16(2)18(19)4/h7-9,15H,5-6,10-14H2,1-4H3,(H,22,23,24) |
| InChIKey | CKHJXRYUHREYER-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|