C18H22F3N5 — CID 112914415
2-(4-ethylpiperazin-1-yl)-6-methyl-N-[2-(trifluoromethyl)phenyl]pyrimidin-4-amine (PubChem CID 112914415) has the molecular formula C18H22F3N5 and a molecular weight of 365.40 g/mol. Its IUPAC name is 2-(4-ethylpiperazin-1-yl)-6-methyl-N-[2-(trifluoromethyl)phenyl]pyrimidin-4-amine.
| Compound Name | 2-(4-ethylpiperazin-1-yl)-6-methyl-N-[2-(trifluoromethyl)phenyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 112914415 |
| Molecular Formula | C18H22F3N5 |
| Molecular Weight | 365.40 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | 2-(4-ethylpiperazin-1-yl)-6-methyl-N-[2-(trifluoromethyl)phenyl]pyrimidin-4-amine |
| SMILES | CCN1CCN(c2nc(C)cc(Nc3ccccc3C(F)(F)F)n2)CC1 |
| InChI | InChI=1S/C18H22F3N5/c1-3-25-8-10-26(11-9-25)17-22-13(2)12-16(24-17)23-15-7-5-4-6-14(15)18(19,20)21/h4-7,12H,3,8-11H2,1-2H3,(H,22,23,24) |
| InChIKey | CUYXRZBDPQOMOS-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.40 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |