C17H22BrN5 — CID 112914058
N-(3-bromo-4-methylphenyl)-6-methyl-2-(4-methylpiperazin-1-yl)pyrimidin-4-amine (PubChem CID 112914058) has the molecular formula C17H22BrN5 and a molecular weight of 376.30 g/mol. Its IUPAC name is N-(3-bromo-4-methylphenyl)-6-methyl-2-(4-methylpiperazin-1-yl)pyrimidin-4-amine.
| Compound Name | N-(3-bromo-4-methylphenyl)-6-methyl-2-(4-methylpiperazin-1-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 112914058 |
| Molecular Formula | C17H22BrN5 |
| Molecular Weight | 376.30 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | N-(3-bromo-4-methylphenyl)-6-methyl-2-(4-methylpiperazin-1-yl)pyrimidin-4-amine |
| SMILES | Cc1cc(Nc2ccc(C)c(Br)c2)nc(N2CCN(C)CC2)n1 |
| InChI | InChI=1S/C17H22BrN5/c1-12-4-5-14(11-15(12)18)20-16-10-13(2)19-17(21-16)23-8-6-22(3)7-9-23/h4-5,10-11H,6-9H2,1-3H3,(H,19,20,21) |
| InChIKey | YGIQHHUBDDWKTO-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.30 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |