C16H17Cl2N5O — CID 112914801
4-[4-(2,3-dichloroanilino)-6-methylpyrimidin-2-yl]piperazine-1-carbaldehyde (PubChem CID 112914801) has the molecular formula C16H17Cl2N5O and a molecular weight of 366.25 g/mol. Its IUPAC name is 4-[4-(2,3-dichloroanilino)-6-methylpyrimidin-2-yl]piperazine-1-carbaldehyde.
| Compound Name | 4-[4-(2,3-dichloroanilino)-6-methylpyrimidin-2-yl]piperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 112914801 |
| Molecular Formula | C16H17Cl2N5O |
| Molecular Weight | 366.25 g/mol |
| Exact Mass | 365.08 |
| IUPAC Name | 4-[4-(2,3-dichloroanilino)-6-methylpyrimidin-2-yl]piperazine-1-carbaldehyde |
| SMILES | Cc1cc(Nc2cccc(Cl)c2Cl)nc(N2CCN(C=O)CC2)n1 |
| InChI | InChI=1S/C16H17Cl2N5O/c1-11-9-14(20-13-4-2-3-12(17)15(13)18)21-16(19-11)23-7-5-22(10-24)6-8-23/h2-4,9-10H,5-8H2,1H3,(H,19,20,21) |
| InChIKey | CWBRTCGFPHRSTB-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.25 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|