C20H21ClN6 — CID 112923923
N-(2-chlorophenyl)-6-methyl-2-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-4-amine (PubChem CID 112923923) has the molecular formula C20H21ClN6 and a molecular weight of 380.88 g/mol. Its IUPAC name is N-(2-chlorophenyl)-6-methyl-2-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-4-amine.
| Compound Name | N-(2-chlorophenyl)-6-methyl-2-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 112923923 |
| Molecular Formula | C20H21ClN6 |
| Molecular Weight | 380.88 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | N-(2-chlorophenyl)-6-methyl-2-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-4-amine |
| SMILES | Cc1cc(Nc2ccccc2Cl)nc(N2CCN(c3ccccn3)CC2)n1 |
| InChI | InChI=1S/C20H21ClN6/c1-15-14-18(24-17-7-3-2-6-16(17)21)25-20(23-15)27-12-10-26(11-13-27)19-8-4-5-9-22-19/h2-9,14H,10-13H2,1H3,(H,23,24,25) |
| InChIKey | UMKCKBVQGAKVFA-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.88 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |