C22H27N7 — CID 112924042
6-methyl-N-(2-propan-2-ylphenyl)-2-(4-pyrimidin-2-ylpiperazin-1-yl)pyrimidin-4-amine (PubChem CID 112924042) has the molecular formula C22H27N7 and a molecular weight of 389.51 g/mol. Its IUPAC name is 6-methyl-N-(2-propan-2-ylphenyl)-2-(4-pyrimidin-2-ylpiperazin-1-yl)pyrimidin-4-amine.
| Compound Name | 6-methyl-N-(2-propan-2-ylphenyl)-2-(4-pyrimidin-2-ylpiperazin-1-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 112924042 |
| Molecular Formula | C22H27N7 |
| Molecular Weight | 389.51 g/mol |
| Exact Mass | 389.23 |
| IUPAC Name | 6-methyl-N-(2-propan-2-ylphenyl)-2-(4-pyrimidin-2-ylpiperazin-1-yl)pyrimidin-4-amine |
| SMILES | Cc1cc(Nc2ccccc2C(C)C)nc(N2CCN(c3ncccn3)CC2)n1 |
| InChI | InChI=1S/C22H27N7/c1-16(2)18-7-4-5-8-19(18)26-20-15-17(3)25-22(27-20)29-13-11-28(12-14-29)21-23-9-6-10-24-21/h4-10,15-16H,11-14H2,1-3H3,(H,25,26,27) |
| InChIKey | OSELTQORYPGJCC-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.51 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |