C21H23ClN6 — CID 112875544
N-(3-chloro-2-methylphenyl)-2-methyl-6-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-4-amine (PubChem CID 112875544) has the molecular formula C21H23ClN6 and a molecular weight of 394.91 g/mol. Its IUPAC name is N-(3-chloro-2-methylphenyl)-2-methyl-6-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-4-amine.
| Compound Name | N-(3-chloro-2-methylphenyl)-2-methyl-6-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 112875544 |
| Molecular Formula | C21H23ClN6 |
| Molecular Weight | 394.91 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | N-(3-chloro-2-methylphenyl)-2-methyl-6-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-4-amine |
| SMILES | Cc1nc(Nc2cccc(Cl)c2C)cc(N2CCN(c3ccccn3)CC2)n1 |
| InChI | InChI=1S/C21H23ClN6/c1-15-17(22)6-5-7-18(15)26-19-14-21(25-16(2)24-19)28-12-10-27(11-13-28)20-8-3-4-9-23-20/h3-9,14H,10-13H2,1-2H3,(H,24,25,26) |
| InChIKey | OZNXUUDERULSBO-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.91 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |