C26H28ClF3N4O3 — CID 58525018
tert-butyl 4-[4-[[6-chloro-3-(hydroxymethyl)quinolin-4-yl]amino]-2-(trifluoromethyl)phenyl]piperazine-1-carboxylate (PubChem CID 58525018) has the molecular formula C26H28ClF3N4O3 and a molecular weight of 536.98 g/mol. Its IUPAC name is tert-butyl 4-[4-[[6-chloro-3-(hydroxymethyl)quinolin-4-yl]amino]-2-(trifluoromethyl)phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[[6-chloro-3-(hydroxymethyl)quinolin-4-yl]amino]-2-(trifluoromethyl)phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 58525018 |
| Molecular Formula | C26H28ClF3N4O3 |
| Molecular Weight | 536.98 g/mol |
| Exact Mass | 536.18 |
| IUPAC Name | tert-butyl 4-[4-[[6-chloro-3-(hydroxymethyl)quinolin-4-yl]amino]-2-(trifluoromethyl)phenyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc(Nc3c(CO)cnc4ccc(Cl)cc34)cc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C26H28ClF3N4O3/c1-25(2,3)37-24(36)34-10-8-33(9-11-34)22-7-5-18(13-20(22)26(28,29)30)32-23-16(15-35)14-31-21-6-4-17(27)12-19(21)23/h4-7,12-14,35H,8-11,15H2,1-3H3,(H,31,32) |
| InChIKey | RBRNCXUKZNFTFV-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 77.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.98 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|