C26H26ClF3N4O3 — CID 58525139
ethyl 6-chloro-4-[4-(4-propanoylpiperazin-1-yl)-3-(trifluoromethyl)anilino]quinoline-3-carboxylate (PubChem CID 58525139) has the molecular formula C26H26ClF3N4O3 and a molecular weight of 534.97 g/mol. Its IUPAC name is ethyl 6-chloro-4-[4-(4-propanoylpiperazin-1-yl)-3-(trifluoromethyl)anilino]quinoline-3-carboxylate.
| Compound Name | ethyl 6-chloro-4-[4-(4-propanoylpiperazin-1-yl)-3-(trifluoromethyl)anilino]quinoline-3-carboxylate |
|---|---|
| PubChem CID | 58525139 |
| Molecular Formula | C26H26ClF3N4O3 |
| Molecular Weight | 534.97 g/mol |
| Exact Mass | 534.16 |
| IUPAC Name | ethyl 6-chloro-4-[4-(4-propanoylpiperazin-1-yl)-3-(trifluoromethyl)anilino]quinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2ccc(Cl)cc2c1Nc1ccc(N2CCN(C(=O)CC)CC2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C26H26ClF3N4O3/c1-3-23(35)34-11-9-33(10-12-34)22-8-6-17(14-20(22)26(28,29)30)32-24-18-13-16(27)5-7-21(18)31-15-19(24)25(36)37-4-2/h5-8,13-15H,3-4,9-12H2,1-2H3,(H,31,32) |
| InChIKey | FAXNMLPMZUDJGR-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.97 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|