C18H16ClN3O2 — CID 17016638
ethyl 6-chloro-4-(2-phenylhydrazinyl)quinoline-3-carboxylate (PubChem CID 17016638) has the molecular formula C18H16ClN3O2 and a molecular weight of 341.80 g/mol. Its IUPAC name is ethyl 6-chloro-4-(2-phenylhydrazinyl)quinoline-3-carboxylate.
| Compound Name | ethyl 6-chloro-4-(2-phenylhydrazinyl)quinoline-3-carboxylate |
|---|---|
| PubChem CID | 17016638 |
| Molecular Formula | C18H16ClN3O2 |
| Molecular Weight | 341.80 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | ethyl 6-chloro-4-(2-phenylhydrazinyl)quinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2ccc(Cl)cc2c1NNc1ccccc1 |
| InChI | InChI=1S/C18H16ClN3O2/c1-2-24-18(23)15-11-20-16-9-8-12(19)10-14(16)17(15)22-21-13-6-4-3-5-7-13/h3-11,21H,2H2,1H3,(H,20,22) |
| InChIKey | JZUZQEZZDMNGDN-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.80 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|