C24H21ClN4O4S — CID 17016661
ethyl 6-chloro-4-[4-(pyridin-3-ylmethylsulfamoyl)anilino]quinoline-3-carboxylate (PubChem CID 17016661) has the molecular formula C24H21ClN4O4S and a molecular weight of 496.98 g/mol. Its IUPAC name is ethyl 6-chloro-4-[4-(pyridin-3-ylmethylsulfamoyl)anilino]quinoline-3-carboxylate.
| Compound Name | ethyl 6-chloro-4-[4-(pyridin-3-ylmethylsulfamoyl)anilino]quinoline-3-carboxylate |
|---|---|
| PubChem CID | 17016661 |
| Molecular Formula | C24H21ClN4O4S |
| Molecular Weight | 496.98 g/mol |
| Exact Mass | 496.10 |
| IUPAC Name | ethyl 6-chloro-4-[4-(pyridin-3-ylmethylsulfamoyl)anilino]quinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2ccc(Cl)cc2c1Nc1ccc(S(=O)(=O)NCc2cccnc2)cc1 |
| InChI | InChI=1S/C24H21ClN4O4S/c1-2-33-24(30)21-15-27-22-10-5-17(25)12-20(22)23(21)29-18-6-8-19(9-7-18)34(31,32)28-14-16-4-3-11-26-13-16/h3-13,15,28H,2,14H2,1H3,(H,27,29) |
| InChIKey | CFUWVLXUJSIEEK-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.98 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |