C16H18N2O5S — CID 1082995
ethyl 2-[4-(pyridin-3-ylmethylsulfamoyl)phenoxy]acetate (PubChem CID 1082995) has the molecular formula C16H18N2O5S and a molecular weight of 350.40 g/mol. Its IUPAC name is ethyl 2-[4-(pyridin-3-ylmethylsulfamoyl)phenoxy]acetate.
| Compound Name | ethyl 2-[4-(pyridin-3-ylmethylsulfamoyl)phenoxy]acetate |
|---|---|
| PubChem CID | 1082995 |
| Molecular Formula | C16H18N2O5S |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | ethyl 2-[4-(pyridin-3-ylmethylsulfamoyl)phenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(S(=O)(=O)NCc2cccnc2)cc1 |
| InChI | InChI=1S/C16H18N2O5S/c1-2-22-16(19)12-23-14-5-7-15(8-6-14)24(20,21)18-11-13-4-3-9-17-10-13/h3-10,18H,2,11-12H2,1H3 |
| InChIKey | ARYKBENZXGJEQR-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |