C19H25N3O3S — CID 109060934
N,N-dipropyl-4-(pyridin-3-ylmethylsulfamoyl)benzamide (PubChem CID 109060934) has the molecular formula C19H25N3O3S and a molecular weight of 375.49 g/mol. Its IUPAC name is N,N-dipropyl-4-(pyridin-3-ylmethylsulfamoyl)benzamide.
| Compound Name | N,N-dipropyl-4-(pyridin-3-ylmethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 109060934 |
| Molecular Formula | C19H25N3O3S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | N,N-dipropyl-4-(pyridin-3-ylmethylsulfamoyl)benzamide |
| SMILES | CCCN(CCC)C(=O)c1ccc(S(=O)(=O)NCc2cccnc2)cc1 |
| InChI | InChI=1S/C19H25N3O3S/c1-3-12-22(13-4-2)19(23)17-7-9-18(10-8-17)26(24,25)21-15-16-6-5-11-20-14-16/h5-11,14,21H,3-4,12-13,15H2,1-2H3 |
| InChIKey | GCIUOYNYWQFEMQ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |