C21H25ClF3N5O2 — CID 86675723
tert-butyl N-[1-[4-[[4-chloro-5-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]piperidin-4-yl]carbamate (PubChem CID 86675723) has the molecular formula C21H25ClF3N5O2 and a molecular weight of 471.91 g/mol. Its IUPAC name is tert-butyl N-[1-[4-[[4-chloro-5-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[4-[[4-chloro-5-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 86675723 |
| Molecular Formula | C21H25ClF3N5O2 |
| Molecular Weight | 471.91 g/mol |
| Exact Mass | 471.16 |
| IUPAC Name | tert-butyl N-[1-[4-[[4-chloro-5-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]piperidin-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCN(c2ccc(Nc3ncc(C(F)(F)F)c(Cl)n3)cc2)CC1 |
| InChI | InChI=1S/C21H25ClF3N5O2/c1-20(2,3)32-19(31)28-14-8-10-30(11-9-14)15-6-4-13(5-7-15)27-18-26-12-16(17(22)29-18)21(23,24)25/h4-7,12,14H,8-11H2,1-3H3,(H,28,31)(H,26,27,29) |
| InChIKey | GYUUYWJYYKZNQX-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.91 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|