C30H36N8O2 — CID 142395344
tert-butyl N-[1-[4-[[4-(1-ethyl-3-pyridin-3-ylpyrazol-4-yl)pyrimidin-2-yl]amino]phenyl]piperidin-4-yl]carbamate (PubChem CID 142395344) has the molecular formula C30H36N8O2 and a molecular weight of 540.67 g/mol. Its IUPAC name is tert-butyl N-[1-[4-[[4-(1-ethyl-3-pyridin-3-ylpyrazol-4-yl)pyrimidin-2-yl]amino]phenyl]piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[4-[[4-(1-ethyl-3-pyridin-3-ylpyrazol-4-yl)pyrimidin-2-yl]amino]phenyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 142395344 |
| Molecular Formula | C30H36N8O2 |
| Molecular Weight | 540.67 g/mol |
| Exact Mass | 540.30 |
| IUPAC Name | tert-butyl N-[1-[4-[[4-(1-ethyl-3-pyridin-3-ylpyrazol-4-yl)pyrimidin-2-yl]amino]phenyl]piperidin-4-yl]carbamate |
| SMILES | CCn1cc(-c2ccnc(Nc3ccc(N4CCC(NC(=O)OC(C)(C)C)CC4)cc3)n2)c(-c2cccnc2)n1 |
| InChI | InChI=1S/C30H36N8O2/c1-5-38-20-25(27(36-38)21-7-6-15-31-19-21)26-12-16-32-28(35-26)33-22-8-10-24(11-9-22)37-17-13-23(14-18-37)34-29(39)40-30(2,3)4/h6-12,15-16,19-20,23H,5,13-14,17-18H2,1-4H3,(H,34,39)(H,32,33,35) |
| InChIKey | NIDSFGRKJNQSOG-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 110.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.67 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|