C26H30N8 — CID 146243307
4-(1-tert-butyl-3-pyridin-3-ylpyrazol-4-yl)-N-(4-piperazin-1-ylphenyl)pyrimidin-2-amine (PubChem CID 146243307) has the molecular formula C26H30N8 and a molecular weight of 454.58 g/mol. Its IUPAC name is 4-(1-tert-butyl-3-pyridin-3-ylpyrazol-4-yl)-N-(4-piperazin-1-ylphenyl)pyrimidin-2-amine.
| Compound Name | 4-(1-tert-butyl-3-pyridin-3-ylpyrazol-4-yl)-N-(4-piperazin-1-ylphenyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 146243307 |
| Molecular Formula | C26H30N8 |
| Molecular Weight | 454.58 g/mol |
| Exact Mass | 454.26 |
| IUPAC Name | 4-(1-tert-butyl-3-pyridin-3-ylpyrazol-4-yl)-N-(4-piperazin-1-ylphenyl)pyrimidin-2-amine |
| SMILES | CC(C)(C)n1cc(-c2ccnc(Nc3ccc(N4CCNCC4)cc3)n2)c(-c2cccnc2)n1 |
| InChI | InChI=1S/C26H30N8/c1-26(2,3)34-18-22(24(32-34)19-5-4-11-28-17-19)23-10-12-29-25(31-23)30-20-6-8-21(9-7-20)33-15-13-27-14-16-33/h4-12,17-18,27H,13-16H2,1-3H3,(H,29,30,31) |
| InChIKey | SZBWUIJYJBCQLG-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 83.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.58 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|