C26H30N8O — CID 142395487
4-(1-ethyl-3-pyridin-3-ylpyrazol-4-yl)-N-[3-methoxy-4-(4-methylpiperazin-1-yl)phenyl]pyrimidin-2-amine (PubChem CID 142395487) has the molecular formula C26H30N8O and a molecular weight of 470.58 g/mol. Its IUPAC name is 4-(1-ethyl-3-pyridin-3-ylpyrazol-4-yl)-N-[3-methoxy-4-(4-methylpiperazin-1-yl)phenyl]pyrimidin-2-amine.
| Compound Name | 4-(1-ethyl-3-pyridin-3-ylpyrazol-4-yl)-N-[3-methoxy-4-(4-methylpiperazin-1-yl)phenyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 142395487 |
| Molecular Formula | C26H30N8O |
| Molecular Weight | 470.58 g/mol |
| Exact Mass | 470.25 |
| IUPAC Name | 4-(1-ethyl-3-pyridin-3-ylpyrazol-4-yl)-N-[3-methoxy-4-(4-methylpiperazin-1-yl)phenyl]pyrimidin-2-amine |
| SMILES | CCn1cc(-c2ccnc(Nc3ccc(N4CCN(C)CC4)c(OC)c3)n2)c(-c2cccnc2)n1 |
| InChI | InChI=1S/C26H30N8O/c1-4-34-18-21(25(31-34)19-6-5-10-27-17-19)22-9-11-28-26(30-22)29-20-7-8-23(24(16-20)35-3)33-14-12-32(2)13-15-33/h5-11,16-18H,4,12-15H2,1-3H3,(H,28,29,30) |
| InChIKey | VHQBUCJGHWJQNW-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.58 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|