C13H10ClF3N4O2 — CID 175488433
[4-[[4-chloro-5-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]methyl carbamate (PubChem CID 175488433) has the molecular formula C13H10ClF3N4O2 and a molecular weight of 346.70 g/mol. Its IUPAC name is [4-[[4-chloro-5-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]methyl carbamate.
| Compound Name | [4-[[4-chloro-5-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]methyl carbamate |
|---|---|
| PubChem CID | 175488433 |
| Molecular Formula | C13H10ClF3N4O2 |
| Molecular Weight | 346.70 g/mol |
| Exact Mass | 346.04 |
| IUPAC Name | [4-[[4-chloro-5-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]methyl carbamate |
| SMILES | NC(=O)OCc1ccc(Nc2ncc(C(F)(F)F)c(Cl)n2)cc1 |
| InChI | InChI=1S/C13H10ClF3N4O2/c14-10-9(13(15,16)17)5-19-12(21-10)20-8-3-1-7(2-4-8)6-23-11(18)22/h1-5H,6H2,(H2,18,22)(H,19,20,21) |
| InChIKey | YGQHDIIPMBQBIB-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.70 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |