C16H17ClF3N3O3P+ — CID 87325956
3-[4-[[4-chloro-5-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]pentan-3-yloxy-hydroxy-oxophosphanium (PubChem CID 87325956) has the molecular formula C16H17ClF3N3O3P+ and a molecular weight of 422.75 g/mol. Its IUPAC name is 3-[4-[[4-chloro-5-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]pentan-3-yloxy-hydroxy-oxophosphanium.
| Compound Name | 3-[4-[[4-chloro-5-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]pentan-3-yloxy-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 87325956 |
| Molecular Formula | C16H17ClF3N3O3P+ |
| Molecular Weight | 422.75 g/mol |
| Exact Mass | 422.06 |
| IUPAC Name | 3-[4-[[4-chloro-5-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]pentan-3-yloxy-hydroxy-oxophosphanium |
| SMILES | CCC(CC)(O[P+](=O)O)c1ccc(Nc2ncc(C(F)(F)F)c(Cl)n2)cc1 |
| InChI | InChI=1S/C16H16ClF3N3O3P/c1-3-15(4-2,26-27(24)25)10-5-7-11(8-6-10)22-14-21-9-12(13(17)23-14)16(18,19)20/h5-9H,3-4H2,1-2H3,(H-,21,22,23,24,25)/p+1 |
| InChIKey | QXSYHMOKGBKRRY-UHFFFAOYSA-O |
| XLogP | 5.57 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.75 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|