C14H13ClF3N3S — CID 86658167
4-chloro-N-(3-propylsulfanylphenyl)-5-(trifluoromethyl)pyrimidin-2-amine (PubChem CID 86658167) has the molecular formula C14H13ClF3N3S and a molecular weight of 347.79 g/mol. Its IUPAC name is 4-chloro-N-(3-propylsulfanylphenyl)-5-(trifluoromethyl)pyrimidin-2-amine.
| Compound Name | 4-chloro-N-(3-propylsulfanylphenyl)-5-(trifluoromethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 86658167 |
| Molecular Formula | C14H13ClF3N3S |
| Molecular Weight | 347.79 g/mol |
| Exact Mass | 347.05 |
| IUPAC Name | 4-chloro-N-(3-propylsulfanylphenyl)-5-(trifluoromethyl)pyrimidin-2-amine |
| SMILES | CCCSc1cccc(Nc2ncc(C(F)(F)F)c(Cl)n2)c1 |
| InChI | InChI=1S/C14H13ClF3N3S/c1-2-6-22-10-5-3-4-9(7-10)20-13-19-8-11(12(15)21-13)14(16,17)18/h3-5,7-8H,2,6H2,1H3,(H,19,20,21) |
| InChIKey | IXNBOSFMJMCZTG-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.79 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |