C15H17ClN4S — CID 166899433
4-chloro-5-methyl-N-(3-pyrrolidin-1-ylsulfanylphenyl)pyrimidin-2-amine (PubChem CID 166899433) has the molecular formula C15H17ClN4S and a molecular weight of 320.85 g/mol. Its IUPAC name is 4-chloro-5-methyl-N-(3-pyrrolidin-1-ylsulfanylphenyl)pyrimidin-2-amine.
| Compound Name | 4-chloro-5-methyl-N-(3-pyrrolidin-1-ylsulfanylphenyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 166899433 |
| Molecular Formula | C15H17ClN4S |
| Molecular Weight | 320.85 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 4-chloro-5-methyl-N-(3-pyrrolidin-1-ylsulfanylphenyl)pyrimidin-2-amine |
| SMILES | Cc1cnc(Nc2cccc(SN3CCCC3)c2)nc1Cl |
| InChI | InChI=1S/C15H17ClN4S/c1-11-10-17-15(19-14(11)16)18-12-5-4-6-13(9-12)21-20-7-2-3-8-20/h4-6,9-10H,2-3,7-8H2,1H3,(H,17,18,19) |
| InChIKey | JZGPMKCFEABQHD-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.85 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|