C23H27ClN6OS — CID 143861932
5-chloro-4-N-[2-(methylsulfanylamino)phenyl]-2-N-[3-(2-pyrrolidin-1-ylethoxy)phenyl]pyrimidine-2,4-diamine (PubChem CID 143861932) has the molecular formula C23H27ClN6OS and a molecular weight of 471.03 g/mol. Its IUPAC name is 5-chloro-4-N-[2-(methylsulfanylamino)phenyl]-2-N-[3-(2-pyrrolidin-1-ylethoxy)phenyl]pyrimidine-2,4-diamine.
| Compound Name | 5-chloro-4-N-[2-(methylsulfanylamino)phenyl]-2-N-[3-(2-pyrrolidin-1-ylethoxy)phenyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 143861932 |
| Molecular Formula | C23H27ClN6OS |
| Molecular Weight | 471.03 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | 5-chloro-4-N-[2-(methylsulfanylamino)phenyl]-2-N-[3-(2-pyrrolidin-1-ylethoxy)phenyl]pyrimidine-2,4-diamine |
| SMILES | CSNc1ccccc1Nc1nc(Nc2cccc(OCCN3CCCC3)c2)ncc1Cl |
| InChI | InChI=1S/C23H27ClN6OS/c1-32-29-21-10-3-2-9-20(21)27-22-19(24)16-25-23(28-22)26-17-7-6-8-18(15-17)31-14-13-30-11-4-5-12-30/h2-3,6-10,15-16,29H,4-5,11-14H2,1H3,(H2,25,26,27,28) |
| InChIKey | WJXUPNSISQLEFF-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 74.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.03 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|