C24H29ClN6O2S — CID 143861921
5-chloro-2-N-[3-methoxy-4-(2-pyrrolidin-1-ylethoxy)phenyl]-4-N-[2-(methylsulfanylamino)phenyl]pyrimidine-2,4-diamine (PubChem CID 143861921) has the molecular formula C24H29ClN6O2S and a molecular weight of 501.06 g/mol. Its IUPAC name is 5-chloro-2-N-[3-methoxy-4-(2-pyrrolidin-1-ylethoxy)phenyl]-4-N-[2-(methylsulfanylamino)phenyl]pyrimidine-2,4-diamine.
| Compound Name | 5-chloro-2-N-[3-methoxy-4-(2-pyrrolidin-1-ylethoxy)phenyl]-4-N-[2-(methylsulfanylamino)phenyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 143861921 |
| Molecular Formula | C24H29ClN6O2S |
| Molecular Weight | 501.06 g/mol |
| Exact Mass | 500.18 |
| IUPAC Name | 5-chloro-2-N-[3-methoxy-4-(2-pyrrolidin-1-ylethoxy)phenyl]-4-N-[2-(methylsulfanylamino)phenyl]pyrimidine-2,4-diamine |
| SMILES | COc1cc(Nc2ncc(Cl)c(Nc3ccccc3NSC)n2)ccc1OCCN1CCCC1 |
| InChI | InChI=1S/C24H29ClN6O2S/c1-32-22-15-17(9-10-21(22)33-14-13-31-11-5-6-12-31)27-24-26-16-18(25)23(29-24)28-19-7-3-4-8-20(19)30-34-2/h3-4,7-10,15-16,30H,5-6,11-14H2,1-2H3,(H2,26,27,28,29) |
| InChIKey | CVTFTLZDMOFNMS-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 83.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.06 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|