C19H20BrN5O2S — CID 143861926
5-bromo-2-N-(3,4-dimethoxyphenyl)-4-N-[2-(methylsulfanylamino)phenyl]pyrimidine-2,4-diamine (PubChem CID 143861926) has the molecular formula C19H20BrN5O2S and a molecular weight of 462.37 g/mol. Its IUPAC name is 5-bromo-2-N-(3,4-dimethoxyphenyl)-4-N-[2-(methylsulfanylamino)phenyl]pyrimidine-2,4-diamine.
| Compound Name | 5-bromo-2-N-(3,4-dimethoxyphenyl)-4-N-[2-(methylsulfanylamino)phenyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 143861926 |
| Molecular Formula | C19H20BrN5O2S |
| Molecular Weight | 462.37 g/mol |
| Exact Mass | 461.05 |
| IUPAC Name | 5-bromo-2-N-(3,4-dimethoxyphenyl)-4-N-[2-(methylsulfanylamino)phenyl]pyrimidine-2,4-diamine |
| SMILES | COc1ccc(Nc2ncc(Br)c(Nc3ccccc3NSC)n2)cc1OC |
| InChI | InChI=1S/C19H20BrN5O2S/c1-26-16-9-8-12(10-17(16)27-2)22-19-21-11-13(20)18(24-19)23-14-6-4-5-7-15(14)25-28-3/h4-11,25H,1-3H3,(H2,21,22,23,24) |
| InChIKey | HAELDILUMGBQEU-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 80.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.37 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|