C23H25BrN6O3 — CID 156831634
2-[[2-[[5-bromo-2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]amino]phenyl]methyl-methylamino]acetonitrile (PubChem CID 156831634) has the molecular formula C23H25BrN6O3 and a molecular weight of 513.40 g/mol. Its IUPAC name is 2-[[2-[[5-bromo-2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]amino]phenyl]methyl-methylamino]acetonitrile.
| Compound Name | 2-[[2-[[5-bromo-2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]amino]phenyl]methyl-methylamino]acetonitrile |
|---|---|
| PubChem CID | 156831634 |
| Molecular Formula | C23H25BrN6O3 |
| Molecular Weight | 513.40 g/mol |
| Exact Mass | 512.12 |
| IUPAC Name | 2-[[2-[[5-bromo-2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]amino]phenyl]methyl-methylamino]acetonitrile |
| SMILES | COc1cc(Nc2ncc(Br)c(Nc3ccccc3CN(C)CC#N)n2)cc(OC)c1OC |
| InChI | InChI=1S/C23H25BrN6O3/c1-30(10-9-25)14-15-7-5-6-8-18(15)28-22-17(24)13-26-23(29-22)27-16-11-19(31-2)21(33-4)20(12-16)32-3/h5-8,11-13H,10,14H2,1-4H3,(H2,26,27,28,29) |
| InChIKey | MANCVZGQBPDHKF-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 104.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.40 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|