C20H23N5O5S — CID 66953463
5-methyl-4-[2-(sulfinoamino)anilino]-2-(3,4,5-trimethoxyanilino)pyrimidine (PubChem CID 66953463) has the molecular formula C20H23N5O5S and a molecular weight of 445.50 g/mol. Its IUPAC name is 5-methyl-4-[2-(sulfinoamino)anilino]-2-(3,4,5-trimethoxyanilino)pyrimidine.
| Compound Name | 5-methyl-4-[2-(sulfinoamino)anilino]-2-(3,4,5-trimethoxyanilino)pyrimidine |
|---|---|
| PubChem CID | 66953463 |
| Molecular Formula | C20H23N5O5S |
| Molecular Weight | 445.50 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | 5-methyl-4-[2-(sulfinoamino)anilino]-2-(3,4,5-trimethoxyanilino)pyrimidine |
| SMILES | COc1cc(Nc2ncc(C)c(Nc3ccccc3NS(=O)O)n2)cc(OC)c1OC |
| InChI | InChI=1S/C20H23N5O5S/c1-12-11-21-20(22-13-9-16(28-2)18(30-4)17(10-13)29-3)24-19(12)23-14-7-5-6-8-15(14)25-31(26)27/h5-11,25H,1-4H3,(H,26,27)(H2,21,22,23,24) |
| InChIKey | RROUYRKFBYYDHH-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 126.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.50 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|