C20H22FN5O6S — CID 66953198
5-fluoro-4-[5-methoxy-2-(sulfinoamino)anilino]-2-(3,4,5-trimethoxyanilino)pyrimidine (PubChem CID 66953198) has the molecular formula C20H22FN5O6S and a molecular weight of 479.49 g/mol. Its IUPAC name is 5-fluoro-4-[5-methoxy-2-(sulfinoamino)anilino]-2-(3,4,5-trimethoxyanilino)pyrimidine.
| Compound Name | 5-fluoro-4-[5-methoxy-2-(sulfinoamino)anilino]-2-(3,4,5-trimethoxyanilino)pyrimidine |
|---|---|
| PubChem CID | 66953198 |
| Molecular Formula | C20H22FN5O6S |
| Molecular Weight | 479.49 g/mol |
| Exact Mass | 479.13 |
| IUPAC Name | 5-fluoro-4-[5-methoxy-2-(sulfinoamino)anilino]-2-(3,4,5-trimethoxyanilino)pyrimidine |
| SMILES | COc1ccc(NS(=O)O)c(Nc2nc(Nc3cc(OC)c(OC)c(OC)c3)ncc2F)c1 |
| InChI | InChI=1S/C20H22FN5O6S/c1-29-12-5-6-14(26-33(27)28)15(9-12)24-19-13(21)10-22-20(25-19)23-11-7-16(30-2)18(32-4)17(8-11)31-3/h5-10,26H,1-4H3,(H,27,28)(H2,22,23,24,25) |
| InChIKey | NQHDYXFMDQITJT-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 136.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.49 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|