C17H15FN5O3S- — CID 66953456
5-fluoro-2-(4-methoxyanilino)-4-[2-(sulfinatoamino)anilino]pyrimidine (PubChem CID 66953456) has the molecular formula C17H15FN5O3S- and a molecular weight of 388.40 g/mol. Its IUPAC name is 5-fluoro-2-(4-methoxyanilino)-4-[2-(sulfinatoamino)anilino]pyrimidine.
| Compound Name | 5-fluoro-2-(4-methoxyanilino)-4-[2-(sulfinatoamino)anilino]pyrimidine |
|---|---|
| PubChem CID | 66953456 |
| Molecular Formula | C17H15FN5O3S- |
| Molecular Weight | 388.40 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | 5-fluoro-2-(4-methoxyanilino)-4-[2-(sulfinatoamino)anilino]pyrimidine |
| SMILES | COc1ccc(Nc2ncc(F)c(Nc3ccccc3NS(=O)[O-])n2)cc1 |
| InChI | InChI=1S/C17H16FN5O3S/c1-26-12-8-6-11(7-9-12)20-17-19-10-13(18)16(22-17)21-14-4-2-3-5-15(14)23-27(24)25/h2-10,23H,1H3,(H,24,25)(H2,19,20,21,22)/p-1 |
| InChIKey | SWRNQSSNSRWDDI-UHFFFAOYSA-M |
| XLogP | 3.32 |
| TPSA | 111.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.40 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|