C19H19F2N5O5S — CID 66953317
5-fluoro-4-[5-fluoro-2-(sulfinoamino)anilino]-2-(3,4,5-trimethoxyanilino)pyrimidine (PubChem CID 66953317) has the molecular formula C19H19F2N5O5S and a molecular weight of 467.45 g/mol. Its IUPAC name is 5-fluoro-4-[5-fluoro-2-(sulfinoamino)anilino]-2-(3,4,5-trimethoxyanilino)pyrimidine.
| Compound Name | 5-fluoro-4-[5-fluoro-2-(sulfinoamino)anilino]-2-(3,4,5-trimethoxyanilino)pyrimidine |
|---|---|
| PubChem CID | 66953317 |
| Molecular Formula | C19H19F2N5O5S |
| Molecular Weight | 467.45 g/mol |
| Exact Mass | 467.11 |
| IUPAC Name | 5-fluoro-4-[5-fluoro-2-(sulfinoamino)anilino]-2-(3,4,5-trimethoxyanilino)pyrimidine |
| SMILES | COc1cc(Nc2ncc(F)c(Nc3cc(F)ccc3NS(=O)O)n2)cc(OC)c1OC |
| InChI | InChI=1S/C19H19F2N5O5S/c1-29-15-7-11(8-16(30-2)17(15)31-3)23-19-22-9-12(21)18(25-19)24-14-6-10(20)4-5-13(14)26-32(27)28/h4-9,26H,1-3H3,(H,27,28)(H2,22,23,24,25) |
| InChIKey | AZLLDQRYMPYZAL-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 126.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.45 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|