C23H26FN6O5P — CID 143265872
6-[[5-fluoro-2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]amino]-2,2-dimethyl-4-(phosphanylmethyl)pyrido[3,2-b][1,4]oxazin-3-one (PubChem CID 143265872) has the molecular formula C23H26FN6O5P and a molecular weight of 516.47 g/mol. Its IUPAC name is 6-[[5-fluoro-2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]amino]-2,2-dimethyl-4-(phosphanylmethyl)pyrido[3,2-b][1,4]oxazin-3-one.
| Compound Name | 6-[[5-fluoro-2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]amino]-2,2-dimethyl-4-(phosphanylmethyl)pyrido[3,2-b][1,4]oxazin-3-one |
|---|---|
| PubChem CID | 143265872 |
| Molecular Formula | C23H26FN6O5P |
| Molecular Weight | 516.47 g/mol |
| Exact Mass | 516.17 |
| IUPAC Name | 6-[[5-fluoro-2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]amino]-2,2-dimethyl-4-(phosphanylmethyl)pyrido[3,2-b][1,4]oxazin-3-one |
| SMILES | COc1cc(Nc2ncc(F)c(Nc3ccc4c(n3)N(CP)C(=O)C(C)(C)O4)n2)cc(OC)c1OC |
| InChI | InChI=1S/C23H26FN6O5P/c1-23(2)21(31)30(11-36)20-14(35-23)6-7-17(28-20)27-19-13(24)10-25-22(29-19)26-12-8-15(32-3)18(34-5)16(9-12)33-4/h6-10H,11,36H2,1-5H3,(H2,25,26,27,28,29) |
| InChIKey | XMYUICXSDDLZLU-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 119.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.47 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|