C23H24FN8O9P — CID 166956850
4-(dinitrosophosphoryloxymethyl)-6-[[5-fluoro-2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]amino]-2,2-dimethylpyrido[3,2-b][1,4]oxazin-3-one (PubChem CID 166956850) has the molecular formula C23H24FN8O9P and a molecular weight of 606.46 g/mol. Its IUPAC name is 4-(dinitrosophosphoryloxymethyl)-6-[[5-fluoro-2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]amino]-2,2-dimethylpyrido[3,2-b][1,4]oxazin-3-one.
| Compound Name | 4-(dinitrosophosphoryloxymethyl)-6-[[5-fluoro-2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]amino]-2,2-dimethylpyrido[3,2-b][1,4]oxazin-3-one |
|---|---|
| PubChem CID | 166956850 |
| Molecular Formula | C23H24FN8O9P |
| Molecular Weight | 606.46 g/mol |
| Exact Mass | 606.14 |
| IUPAC Name | 4-(dinitrosophosphoryloxymethyl)-6-[[5-fluoro-2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]amino]-2,2-dimethylpyrido[3,2-b][1,4]oxazin-3-one |
| SMILES | COc1cc(Nc2ncc(F)c(Nc3ccc4c(n3)N(COP(=O)(N=O)N=O)C(=O)C(C)(C)O4)n2)cc(OC)c1OC |
| InChI | InChI=1S/C23H24FN8O9P/c1-23(2)21(33)32(11-40-42(36,30-34)31-35)20-14(41-23)6-7-17(28-20)27-19-13(24)10-25-22(29-19)26-12-8-15(37-3)18(39-5)16(9-12)38-4/h6-10H,11H2,1-5H3,(H2,25,26,27,28,29) |
| InChIKey | HELAFUZNMGWXHN-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 205.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.46 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|