C35H56FN8O9P — CID 118160885
[6-[[5-fluoro-2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]amino]-2,2-dimethyl-3-oxopyrido[3,2-b][1,4]oxazin-4-yl]methyl phosphate;bis(triethylazanium) (PubChem CID 118160885) has the molecular formula C35H56FN8O9P and a molecular weight of 782.85 g/mol. Its IUPAC name is [6-[[5-fluoro-2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]amino]-2,2-dimethyl-3-oxopyrido[3,2-b][1,4]oxazin-4-yl]methyl phosphate;bis(triethylazanium).
| Compound Name | [6-[[5-fluoro-2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]amino]-2,2-dimethyl-3-oxopyrido[3,2-b][1,4]oxazin-4-yl]methyl phosphate;bis(triethylazanium) |
|---|---|
| PubChem CID | 118160885 |
| Molecular Formula | C35H56FN8O9P |
| Molecular Weight | 782.85 g/mol |
| Exact Mass | 782.39 |
| IUPAC Name | [6-[[5-fluoro-2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]amino]-2,2-dimethyl-3-oxopyrido[3,2-b][1,4]oxazin-4-yl]methyl phosphate;bis(triethylazanium) |
| SMILES | CC[NH+](CC)CC.CC[NH+](CC)CC.COc1cc(Nc2ncc(F)c(Nc3ccc4c(n3)N(COP(=O)([O-])[O-])C(=O)C(C)(C)O4)n2)cc(OC)c1OC |
| InChI | InChI=1S/C23H26FN6O9P.2C6H15N/c1-23(2)21(31)30(11-38-40(32,33)34)20-14(39-23)6-7-17(28-20)27-19-13(24)10-25-22(29-19)26-12-8-15(35-3)18(37-5)16(9-12)36-4;2*1-4-7(5-2)6-3/h6-10H,11H2,1-5H3,(H2,32,33,34)(H2,25,26,27,28,29);2*4-6H2,1-3H3 |
| InChIKey | PXTRHRVRKJOAIP-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 201.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.85 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|