C26H33FN7O9P — CID 143681383
1-aminopropyl [6-[[5-fluoro-2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]amino]-2,2-dimethyl-3-oxopyrido[3,2-b][1,4]oxazin-4-yl]methyl hydrogen phosphate (PubChem CID 143681383) has the molecular formula C26H33FN7O9P and a molecular weight of 637.56 g/mol. Its IUPAC name is 1-aminopropyl [6-[[5-fluoro-2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]amino]-2,2-dimethyl-3-oxopyrido[3,2-b][1,4]oxazin-4-yl]methyl hydrogen phosphate.
| Compound Name | 1-aminopropyl [6-[[5-fluoro-2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]amino]-2,2-dimethyl-3-oxopyrido[3,2-b][1,4]oxazin-4-yl]methyl hydrogen phosphate |
|---|---|
| PubChem CID | 143681383 |
| Molecular Formula | C26H33FN7O9P |
| Molecular Weight | 637.56 g/mol |
| Exact Mass | 637.21 |
| IUPAC Name | 1-aminopropyl [6-[[5-fluoro-2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]amino]-2,2-dimethyl-3-oxopyrido[3,2-b][1,4]oxazin-4-yl]methyl hydrogen phosphate |
| SMILES | CCC(N)OP(=O)(O)OCN1C(=O)C(C)(C)Oc2ccc(Nc3nc(Nc4cc(OC)c(OC)c(OC)c4)ncc3F)nc21 |
| InChI | InChI=1S/C26H33FN7O9P/c1-7-19(28)43-44(36,37)41-13-34-23-16(42-26(2,3)24(34)35)8-9-20(32-23)31-22-15(27)12-29-25(33-22)30-14-10-17(38-4)21(40-6)18(11-14)39-5/h8-12,19H,7,13,28H2,1-6H3,(H,36,37)(H2,29,30,31,32,33) |
| InChIKey | WKWLZDOWZJBLAF-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 201.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.56 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|